| DRUG INFORMATION |
| Drug Name |
| Rifapentine |
 |
| Synonyms |
| Priftin (TN), RIFAPENTINE, C08059, 61379-65-5 |
| CAS No: |
| 61379-65-5 |
| PHARMACOLOGY |
| Route |
| PO |
| Side effects |
| Frequent: orange discoloration of urine, tears (contact lens), sweat. Occasional: hepatitis.
|
| Usual Adult Dosage |
| 10mg/kg (600mg)q week (w/ INH as part of the continuation phase) or 600 mg po 2x/week.
|
| Form |
| cap |
| Brand Name |
| Priftin |
| Manufacturer |
| Aventis Pharmaceuticals (HMR), P.O. Box 9627 / 10236 Marion Park Dr, Kansas City, MO, 64134-0627 ,(888) 242-9321 |
| STRUCTURAL DETAILS |
| Molecular Formula |
| C47H64N4O12 |
| Molecular Weight in g/mol |
| 877.031 |
| Hydrogen Bond Donor Count |
| 6 |
| Hydrogen Bond Acceptor Count |
| 15 |
| Rotatable Bond Count |
| 6 |
| SMILES |
| Isomeric SMILES: C[C@@H]1C=CC=C(C(=O)N=C2C(=CNN3CCN(CC3)C4CCCC4)C(=C5C(=C2O)C(=C(C6=C5C(=O)[C@](O6)(OC=C[C@@H]([C@H]([C@H]([C@H]([C@H]([C@@H]([C@@H]1O)C)O)C)OC(=O)C)C)OC)C)C)O)O)C
|
| InChI |
| 1/C47H64N4O12/c1-24-13-12-14-25(2)46(59)49-37-32(23-48-51-20-18-50(19-21-51)31-15-10-11-16-31)41(56)34-35(42(37)57)40(55)29(6)44-36(34)45(58)47(8,63-44)61-22-17-33(60-9)26(3)43(62-30(7)52)28(5)39(54)27(4)38(24)53/h12-14,17,22-24,26-28,31,33,38-39,43,48
,53-57H,10-11,15-16,18-21H2,1-9H3/t24-,26-,27-,28+,33+,38-,39+,43-,47+/m1/s1
|